C16H16Br2N2O3 — CID 19208018
N-[(E)-(5-bromofuran-2-yl)methylideneamino]-2-(4-bromo-2-propan-2-ylphenoxy)acetamide (PubChem CID 19208018) has the molecular formula C16H16Br2N2O3 and a molecular weight of 444.12 g/mol. Its IUPAC name is N-[(E)-(5-bromofuran-2-yl)methylideneamino]-2-(4-bromo-2-propan-2-ylphenoxy)acetamide.
| Compound Name | N-[(E)-(5-bromofuran-2-yl)methylideneamino]-2-(4-bromo-2-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 19208018 |
| Molecular Formula | C16H16Br2N2O3 |
| Molecular Weight | 444.12 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | N-[(E)-(5-bromofuran-2-yl)methylideneamino]-2-(4-bromo-2-propan-2-ylphenoxy)acetamide |
| SMILES | CC(C)c1cc(Br)ccc1OCC(=O)N/N=C/c1ccc(Br)o1 |
| InChI | InChI=1S/C16H16Br2N2O3/c1-10(2)13-7-11(17)3-5-14(13)22-9-16(21)20-19-8-12-4-6-15(18)23-12/h3-8,10H,9H2,1-2H3,(H,20,21)/b19-8+ |
| InChIKey | BVGLWDBNPQRWCJ-UFWORHAWSA-N |
| XLogP | 4.46 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.12 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|