C15H13Br2ClN2O3 — CID 19207893
2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(5-bromofuran-2-yl)methylideneamino]acetamide (PubChem CID 19207893) has the molecular formula C15H13Br2ClN2O3 and a molecular weight of 464.54 g/mol. Its IUPAC name is 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(5-bromofuran-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(5-bromofuran-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19207893 |
| Molecular Formula | C15H13Br2ClN2O3 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 461.90 |
| IUPAC Name | 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(5-bromofuran-2-yl)methylideneamino]acetamide |
| SMILES | Cc1cc(OCC(=O)N/N=C/c2ccc(Br)o2)c(Br)c(C)c1Cl |
| InChI | InChI=1S/C15H13Br2ClN2O3/c1-8-5-11(14(17)9(2)15(8)18)22-7-13(21)20-19-6-10-3-4-12(16)23-10/h3-6H,7H2,1-2H3,(H,20,21)/b19-6+ |
| InChIKey | XNXDQXNHIXYIKA-KPSZGOFPSA-N |
| XLogP | 4.60 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|