C17H15BrClN3O4 — CID 19207826
2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide (PubChem CID 19207826) has the molecular formula C17H15BrClN3O4 and a molecular weight of 440.68 g/mol. Its IUPAC name is 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19207826 |
| Molecular Formula | C17H15BrClN3O4 |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(OCC(=O)N/N=C/c2cccc([N+](=O)[O-])c2)c(Br)c(C)c1Cl |
| InChI | InChI=1S/C17H15BrClN3O4/c1-10-6-14(16(18)11(2)17(10)19)26-9-15(23)21-20-8-12-4-3-5-13(7-12)22(24)25/h3-8H,9H2,1-2H3,(H,21,23)/b20-8+ |
| InChIKey | IQDCZPWBIFYQHK-DNTJNYDQSA-N |
| XLogP | 4.16 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|