C22H15F3N4O6 — CID 3944359
2-(2-nitrophenyl)-N-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]acetamide (PubChem CID 3944359) has the molecular formula C22H15F3N4O6 and a molecular weight of 488.38 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-N-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-nitrophenyl)-N-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3944359 |
| Molecular Formula | C22H15F3N4O6 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 2-(2-nitrophenyl)-N-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])NN=Cc1ccc(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H15F3N4O6/c23-22(24,25)16-7-10-20(19(12-16)29(33)34)35-17-8-5-14(6-9-17)13-26-27-21(30)11-15-3-1-2-4-18(15)28(31)32/h1-10,12-13H,11H2,(H,27,30) |
| InChIKey | YIQITUHMGMBFDV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|