C22H15F3N4O2 — CID 46925799
3-phenyl-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 46925799) has the molecular formula C22H15F3N4O2 and a molecular weight of 424.38 g/mol. Its IUPAC name is 3-phenyl-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-phenyl-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46925799 |
| Molecular Formula | C22H15F3N4O2 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 3-phenyl-N-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(-c2cccc(C(F)(F)F)c2)o1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C22H15F3N4O2/c23-22(24,25)16-8-4-7-15(11-16)20-10-9-17(31-20)13-26-29-21(30)19-12-18(27-28-19)14-5-2-1-3-6-14/h1-13H,(H,27,28)(H,29,30)/b26-13+ |
| InChIKey | QHHAYHOSZUOYRO-LGJNPRDNSA-N |
| XLogP | 5.12 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|