C18H18F3N3O3 — CID 155532626
(3R,5S)-5-[(2E)-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]piperidine-3-carboxylic acid (PubChem CID 155532626) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is (3R,5S)-5-[(2E)-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-5-[(2E)-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155532626 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (3R,5S)-5-[(2E)-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CNC[C@@H](N/N=C/c2ccc(-c3cccc(C(F)(F)F)c3)o2)C1 |
| InChI | InChI=1S/C18H18F3N3O3/c19-18(20,21)13-3-1-2-11(6-13)16-5-4-15(27-16)10-23-24-14-7-12(17(25)26)8-22-9-14/h1-6,10,12,14,22,24H,7-9H2,(H,25,26)/b23-10+/t12-,14+/m1/s1 |
| InChIKey | ZTNQUBYRJKBXSA-JAWCBCCNSA-N |
| XLogP | 2.95 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|