C22H17F3N2O2 — CID 11914327
trans-(1S,2S)-2-phenyl-N-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]cyclopropane-1-carboxamide (PubChem CID 11914327) has the molecular formula C22H17F3N2O2 and a molecular weight of 398.38 g/mol. Its IUPAC name is trans-(1S,2S)-2-phenyl-N-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-phenyl-N-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 11914327 |
| Molecular Formula | C22H17F3N2O2 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | trans-(1S,2S)-2-phenyl-N-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]cyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(-c2cccc(C(F)(F)F)c2)o1)[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H17F3N2O2/c23-22(24,25)16-8-4-7-15(11-16)20-10-9-17(29-20)13-26-27-21(28)19-12-18(19)14-5-2-1-3-6-14/h1-11,13,18-19H,12H2,(H,27,28)/b26-13-/t18-,19+/m1/s1 |
| InChIKey | VDWHDQUEGVUSLU-FPHMULMYSA-N |
| XLogP | 5.22 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|