C27H24ClN5O3S2 — CID 6869106
N-[5-[2-[(2E)-2-[[4-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide (PubChem CID 6869106) has the molecular formula C27H24ClN5O3S2 and a molecular weight of 566.11 g/mol. Its IUPAC name is N-[5-[2-[(2E)-2-[[4-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide.
| Compound Name | N-[5-[2-[(2E)-2-[[4-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 6869106 |
| Molecular Formula | C27H24ClN5O3S2 |
| Molecular Weight | 566.11 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | N-[5-[2-[(2E)-2-[[4-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1nnc(CC(=O)N/N=C/c2ccc(OCCSc3ccc(Cl)cc3)cc2)s1 |
| InChI | InChI=1S/C27H24ClN5O3S2/c1-18-4-2-3-5-23(18)26(35)30-27-33-32-25(38-27)16-24(34)31-29-17-19-6-10-21(11-7-19)36-14-15-37-22-12-8-20(28)9-13-22/h2-13,17H,14-16H2,1H3,(H,31,34)(H,30,33,35)/b29-17+ |
| InChIKey | LAZQRTHOUIHICH-STBIYBPSSA-N |
| XLogP | 5.62 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.11 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|