C28H26FN5O4S — CID 6000189
N-[5-[2-[(2Z)-2-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide (PubChem CID 6000189) has the molecular formula C28H26FN5O4S and a molecular weight of 547.61 g/mol. Its IUPAC name is N-[5-[2-[(2Z)-2-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide.
| Compound Name | N-[5-[2-[(2Z)-2-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 6000189 |
| Molecular Formula | C28H26FN5O4S |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | N-[5-[2-[(2Z)-2-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2nnc(NC(=O)c3ccccc3C)s2)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C28H26FN5O4S/c1-3-37-24-14-19(12-13-23(24)38-17-20-9-5-7-11-22(20)29)16-30-32-25(35)15-26-33-34-28(39-26)31-27(36)21-10-6-4-8-18(21)2/h4-14,16H,3,15,17H2,1-2H3,(H,32,35)(H,31,34,36)/b30-16- |
| InChIKey | ZICZOKGGAJSMNE-UHBFCERESA-N |
| XLogP | 4.91 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|