C30H25N5O3S — CID 3695897
2-methyl-N-[5-[2-[2-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 3695897) has the molecular formula C30H25N5O3S and a molecular weight of 535.63 g/mol. Its IUPAC name is 2-methyl-N-[5-[2-[2-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-methyl-N-[5-[2-[2-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3695897 |
| Molecular Formula | C30H25N5O3S |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | 2-methyl-N-[5-[2-[2-[[3-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1nnc(CC(=O)NN=Cc2cccc(OCc3cccc4ccccc34)c2)s1 |
| InChI | InChI=1S/C30H25N5O3S/c1-20-8-2-4-14-25(20)29(37)32-30-35-34-28(39-30)17-27(36)33-31-18-21-9-6-13-24(16-21)38-19-23-12-7-11-22-10-3-5-15-26(22)23/h2-16,18H,17,19H2,1H3,(H,33,36)(H,32,35,37) |
| InChIKey | WEQLTQJOCJEISK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|