C28H23N5O5S — CID 6040613
N-[5-[2-[(2Z)-2-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide (PubChem CID 6040613) has the molecular formula C28H23N5O5S and a molecular weight of 541.59 g/mol. Its IUPAC name is N-[5-[2-[(2Z)-2-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[2-[(2Z)-2-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 6040613 |
| Molecular Formula | C28H23N5O5S |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | N-[5-[2-[(2Z)-2-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)Cc2nnc(NC(=O)c3ccco3)s2)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H23N5O5S/c1-36-24-14-18(11-12-22(24)38-17-20-8-4-7-19-6-2-3-9-21(19)20)16-29-31-25(34)15-26-32-33-28(39-26)30-27(35)23-10-5-13-37-23/h2-14,16H,15,17H2,1H3,(H,31,34)(H,30,33,35)/b29-16- |
| InChIKey | HNBSWBAVMAQYOZ-MWLSYYOVSA-N |
| XLogP | 4.82 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|