C16H11Cl2N5O3S — CID 1284119
N-[5-[2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide (PubChem CID 1284119) has the molecular formula C16H11Cl2N5O3S and a molecular weight of 424.27 g/mol. Its IUPAC name is N-[5-[2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1284119 |
| Molecular Formula | C16H11Cl2N5O3S |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | N-[5-[2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Cc1nnc(NC(=O)c2ccco2)s1)NN=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H11Cl2N5O3S/c17-10-3-1-4-11(18)9(10)8-19-21-13(24)7-14-22-23-16(27-14)20-15(25)12-5-2-6-26-12/h1-6,8H,7H2,(H,21,24)(H,20,23,25) |
| InChIKey | VTBGGGFIPXNMPL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|