C13H10Cl3N5O2S — CID 6311857
2,2-dichloro-N-[5-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 6311857) has the molecular formula C13H10Cl3N5O2S and a molecular weight of 406.68 g/mol. Its IUPAC name is 2,2-dichloro-N-[5-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[5-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 6311857 |
| Molecular Formula | C13H10Cl3N5O2S |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 404.96 |
| IUPAC Name | 2,2-dichloro-N-[5-[2-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1nnc(NC(=O)C(Cl)Cl)s1)N/N=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10Cl3N5O2S/c14-8-3-1-7(2-4-8)6-17-19-9(22)5-10-20-21-13(24-10)18-12(23)11(15)16/h1-4,6,11H,5H2,(H,19,22)(H,18,21,23)/b17-6- |
| InChIKey | CKBYSBWXMLFYLP-FMQZQXMHSA-N |
| XLogP | 2.63 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|