C13H11Cl2N5O4S — CID 137060092
2,2-dichloro-N-[5-[2-[(2Z)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 137060092) has the molecular formula C13H11Cl2N5O4S and a molecular weight of 404.24 g/mol. Its IUPAC name is 2,2-dichloro-N-[5-[2-[(2Z)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[5-[2-[(2Z)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 137060092 |
| Molecular Formula | C13H11Cl2N5O4S |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 2,2-dichloro-N-[5-[2-[(2Z)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1nnc(NC(=O)C(Cl)Cl)s1)N/N=C\c1ccc(O)cc1O |
| InChI | InChI=1S/C13H11Cl2N5O4S/c14-11(15)12(24)17-13-20-19-10(25-13)4-9(23)18-16-5-6-1-2-7(21)3-8(6)22/h1-3,5,11,21-22H,4H2,(H,18,23)(H,17,20,24)/b16-5- |
| InChIKey | JXNYWWZZAYVFHL-BNCCVWRVSA-N |
| XLogP | 1.38 |
| TPSA | 136.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|