C15H16BrN5O3S — CID 135899802
N-[5-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 135899802) has the molecular formula C15H16BrN5O3S and a molecular weight of 426.30 g/mol. Its IUPAC name is N-[5-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | N-[5-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 135899802 |
| Molecular Formula | C15H16BrN5O3S |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | N-[5-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nnc(CC(=O)N/N=C\c2cc(Br)ccc2O)s1 |
| InChI | InChI=1S/C15H16BrN5O3S/c1-2-3-12(23)18-15-21-20-14(25-15)7-13(24)19-17-8-9-6-10(16)4-5-11(9)22/h4-6,8,22H,2-3,7H2,1H3,(H,19,24)(H,18,21,23)/b17-8- |
| InChIKey | KPUWHFJRBOJADK-IUXPMGMMSA-N |
| XLogP | 2.44 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|