C17H21N5O4S — CID 137060171
N-[5-[2-[(2Z)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]pentanamide (PubChem CID 137060171) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[5-[2-[(2Z)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]pentanamide.
| Compound Name | N-[5-[2-[(2Z)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 137060171 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-[5-[2-[(2Z)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1nnc(CC(=O)N/N=C\c2cccc(OC)c2O)s1 |
| InChI | InChI=1S/C17H21N5O4S/c1-3-4-8-13(23)19-17-22-21-15(27-17)9-14(24)20-18-10-11-6-5-7-12(26-2)16(11)25/h5-7,10,25H,3-4,8-9H2,1-2H3,(H,20,24)(H,19,22,23)/b18-10- |
| InChIKey | QYSJLDZRGKJXRZ-ZDLGFXPLSA-N |
| XLogP | 2.07 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|