C19H22N6O2S — CID 4037183
N-[5-[2-[2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]pentanamide (PubChem CID 4037183) has the molecular formula C19H22N6O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[5-[2-[2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]pentanamide.
| Compound Name | N-[5-[2-[2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 4037183 |
| Molecular Formula | C19H22N6O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[5-[2-[2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1nnc(CC(=O)NN=Cc2c(C)[nH]c3ccccc23)s1 |
| InChI | InChI=1S/C19H22N6O2S/c1-3-4-9-16(26)22-19-25-24-18(28-19)10-17(27)23-20-11-14-12(2)21-15-8-6-5-7-13(14)15/h5-8,11,21H,3-4,9-10H2,1-2H3,(H,23,27)(H,22,25,26) |
| InChIKey | OQRJWXKEQZGIIC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|