C14H17N3O3S2 — CID 17321419
N-[5-(benzenesulfonylmethyl)-1,3,4-thiadiazol-2-yl]pentanamide (PubChem CID 17321419) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[5-(benzenesulfonylmethyl)-1,3,4-thiadiazol-2-yl]pentanamide.
| Compound Name | N-[5-(benzenesulfonylmethyl)-1,3,4-thiadiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 17321419 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[5-(benzenesulfonylmethyl)-1,3,4-thiadiazol-2-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1nnc(CS(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-2-3-9-12(18)15-14-17-16-13(21-14)10-22(19,20)11-7-5-4-6-8-11/h4-8H,2-3,9-10H2,1H3,(H,15,17,18) |
| InChIKey | JUXXWLOCXPMCNO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |