C20H24N6O2S — CID 137060109
N-[5-[2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]heptanamide (PubChem CID 137060109) has the molecular formula C20H24N6O2S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[5-[2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]heptanamide.
| Compound Name | N-[5-[2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]heptanamide |
|---|---|
| PubChem CID | 137060109 |
| Molecular Formula | C20H24N6O2S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[5-[2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1nnc(CC(=O)N/N=C\c2c[nH]c3ccccc23)s1 |
| InChI | InChI=1S/C20H24N6O2S/c1-2-3-4-5-10-17(27)23-20-26-25-19(29-20)11-18(28)24-22-13-14-12-21-16-9-7-6-8-15(14)16/h6-9,12-13,21H,2-5,10-11H2,1H3,(H,24,28)(H,23,26,27)/b22-13- |
| InChIKey | KQIAKCXRLDZDMY-XKZIYDEJSA-N |
| XLogP | 3.62 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|