C19H16BrN5O2S — CID 3886861
N-[5-[2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide (PubChem CID 3886861) has the molecular formula C19H16BrN5O2S and a molecular weight of 458.34 g/mol. Its IUPAC name is N-[5-[2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide.
| Compound Name | N-[5-[2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 3886861 |
| Molecular Formula | C19H16BrN5O2S |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | N-[5-[2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2nnc(CC(=O)NN=Cc3ccc(Br)cc3)s2)c1 |
| InChI | InChI=1S/C19H16BrN5O2S/c1-12-3-2-4-14(9-12)18(27)22-19-25-24-17(28-19)10-16(26)23-21-11-13-5-7-15(20)8-6-13/h2-9,11H,10H2,1H3,(H,23,26)(H,22,25,27) |
| InChIKey | NKUNBTQMSSWZTQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|