C20H16BrN5O4S — CID 4673187
N-[5-[2-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide (PubChem CID 4673187) has the molecular formula C20H16BrN5O4S and a molecular weight of 502.35 g/mol. Its IUPAC name is N-[5-[2-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide.
| Compound Name | N-[5-[2-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 4673187 |
| Molecular Formula | C20H16BrN5O4S |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | N-[5-[2-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nnc(CC(=O)NN=Cc3cc4c(cc3Br)OCO4)s2)cc1 |
| InChI | InChI=1S/C20H16BrN5O4S/c1-11-2-4-12(5-3-11)19(28)23-20-26-25-18(31-20)8-17(27)24-22-9-13-6-15-16(7-14(13)21)30-10-29-15/h2-7,9H,8,10H2,1H3,(H,24,27)(H,23,26,28) |
| InChIKey | DUIGXPFTRVMZRT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|