C26H21Cl2N5O3S — CID 124544550
N-[5-[2-[(2Z)-2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide (PubChem CID 124544550) has the molecular formula C26H21Cl2N5O3S and a molecular weight of 554.46 g/mol. Its IUPAC name is N-[5-[2-[(2Z)-2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide.
| Compound Name | N-[5-[2-[(2Z)-2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 124544550 |
| Molecular Formula | C26H21Cl2N5O3S |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | N-[5-[2-[(2Z)-2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2nnc(CC(=O)N/N=C\c3ccc(OCc4ccc(Cl)cc4Cl)cc3)s2)c1 |
| InChI | InChI=1S/C26H21Cl2N5O3S/c1-16-3-2-4-18(11-16)25(35)30-26-33-32-24(37-26)13-23(34)31-29-14-17-5-9-21(10-6-17)36-15-19-7-8-20(27)12-22(19)28/h2-12,14H,13,15H2,1H3,(H,31,34)(H,30,33,35)/b29-14- |
| InChIKey | CEWLALMBLJGFFT-NUJZUDFISA-N |
| XLogP | 5.68 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|