C27H23Cl2N5O4S — CID 6293082
N-[5-[2-[(2Z)-2-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 6293082) has the molecular formula C27H23Cl2N5O4S and a molecular weight of 584.49 g/mol. Its IUPAC name is N-[5-[2-[(2Z)-2-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-[2-[(2Z)-2-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 6293082 |
| Molecular Formula | C27H23Cl2N5O4S |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | N-[5-[2-[(2Z)-2-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2nnc(NC(=O)c3ccccc3)s2)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C27H23Cl2N5O4S/c1-2-37-22-13-17(12-21(29)25(22)38-16-19-10-6-7-11-20(19)28)15-30-32-23(35)14-24-33-34-27(39-24)31-26(36)18-8-4-3-5-9-18/h3-13,15H,2,14,16H2,1H3,(H,32,35)(H,31,34,36)/b30-15- |
| InChIKey | PQKIYXLCQLDMPS-MNDYBZJGSA-N |
| XLogP | 5.77 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|