C28H27N5O4S — CID 3822181
N-[5-[2-[2-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide (PubChem CID 3822181) has the molecular formula C28H27N5O4S and a molecular weight of 529.62 g/mol. Its IUPAC name is N-[5-[2-[2-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide.
| Compound Name | N-[5-[2-[2-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 3822181 |
| Molecular Formula | C28H27N5O4S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | N-[5-[2-[2-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
| SMILES | CCOc1cc(C=NNC(=O)Cc2nnc(NC(=O)c3ccccc3C)s2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H27N5O4S/c1-3-36-24-15-21(13-14-23(24)37-18-20-10-5-4-6-11-20)17-29-31-25(34)16-26-32-33-28(38-26)30-27(35)22-12-8-7-9-19(22)2/h4-15,17H,3,16,18H2,1-2H3,(H,31,34)(H,30,33,35) |
| InChIKey | OXOZIZLUQWRIIX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|