C14H13Cl2N5O2S — CID 3930604
N-[5-[2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 3930604) has the molecular formula C14H13Cl2N5O2S and a molecular weight of 386.26 g/mol. Its IUPAC name is N-[5-[2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-[5-[2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 3930604 |
| Molecular Formula | C14H13Cl2N5O2S |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | N-[5-[2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)Nc1nnc(CC(=O)NN=Cc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C14H13Cl2N5O2S/c1-2-11(22)18-14-21-20-13(24-14)6-12(23)19-17-7-8-3-4-9(15)5-10(8)16/h3-5,7H,2,6H2,1H3,(H,19,23)(H,18,21,22) |
| InChIKey | NGRGFCSUQWIDPN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|