C12H10Cl2N4OS — CID 96890236
2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]acetamide (PubChem CID 96890236) has the molecular formula C12H10Cl2N4OS and a molecular weight of 329.21 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 96890236 |
| Molecular Formula | C12H10Cl2N4OS |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-(2,4-dichlorophenyl)methylideneamino]acetamide |
| SMILES | Nc1nc(CC(=O)N/N=C/c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C12H10Cl2N4OS/c13-8-2-1-7(10(14)3-8)5-16-18-11(19)4-9-6-20-12(15)17-9/h1-3,5-6H,4H2,(H2,15,17)(H,18,19)/b16-5+ |
| InChIKey | AUHHHIRHGCOUAQ-FZSIALSZSA-N |
| XLogP | 2.72 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|