C10H9N5O3S2 — CID 40547510
2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]acetamide (PubChem CID 40547510) has the molecular formula C10H9N5O3S2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 40547510 |
| Molecular Formula | C10H9N5O3S2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]acetamide |
| SMILES | Nc1nc(CC(=O)N/N=C/c2ccc([N+](=O)[O-])s2)cs1 |
| InChI | InChI=1S/C10H9N5O3S2/c11-10-13-6(5-19-10)3-8(16)14-12-4-7-1-2-9(20-7)15(17)18/h1-2,4-5H,3H2,(H2,11,13)(H,14,16)/b12-4+ |
| InChIKey | MHBSDJSGYBEKJT-UUILKARUSA-N |
| XLogP | 1.39 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|