C15H15N3O5S — CID 5390870
2-(3,4-dimethoxyphenyl)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide (PubChem CID 5390870) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5390870 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide |
| SMILES | COc1ccc(CC(=O)N/N=C\c2ccc([N+](=O)[O-])s2)cc1OC |
| InChI | InChI=1S/C15H15N3O5S/c1-22-12-5-3-10(7-13(12)23-2)8-14(19)17-16-9-11-4-6-15(24-11)18(20)21/h3-7,9H,8H2,1-2H3,(H,17,19)/b16-9- |
| InChIKey | MSBHVPBOLIOIOR-SXGWCWSVSA-N |
| XLogP | 2.37 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|