C29H28N4O5 — CID 126368990
2-(3,4-dimethoxyphenyl)-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide (PubChem CID 126368990) has the molecular formula C29H28N4O5 and a molecular weight of 512.57 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126368990 |
| Molecular Formula | C29H28N4O5 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(CC(=O)N/N=C/c2cc(C)n(-c3ccc(-c4ccc([N+](=O)[O-])cc4)cc3)c2C)cc1OC |
| InChI | InChI=1S/C29H28N4O5/c1-19-15-24(18-30-31-29(34)17-21-5-14-27(37-3)28(16-21)38-4)20(2)32(19)25-10-6-22(7-11-25)23-8-12-26(13-9-23)33(35)36/h5-16,18H,17H2,1-4H3,(H,31,34)/b30-18+ |
| InChIKey | NNOXVGJGIHBIKG-UXHLAJHPSA-N |
| XLogP | 5.38 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|