C20H19ClN4O3 — CID 126071250
N-[(Z)-[1-(3-chloro-4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-nitroaniline (PubChem CID 126071250) has the molecular formula C20H19ClN4O3 and a molecular weight of 398.85 g/mol. Its IUPAC name is N-[(Z)-[1-(3-chloro-4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-nitroaniline.
| Compound Name | N-[(Z)-[1-(3-chloro-4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 126071250 |
| Molecular Formula | C20H19ClN4O3 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-[(Z)-[1-(3-chloro-4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-nitroaniline |
| SMILES | COc1ccc(-n2c(C)cc(/C=N\Nc3ccc([N+](=O)[O-])cc3)c2C)cc1Cl |
| InChI | InChI=1S/C20H19ClN4O3/c1-13-10-15(12-22-23-16-4-6-17(7-5-16)25(26)27)14(2)24(13)18-8-9-20(28-3)19(21)11-18/h4-12,23H,1-3H3/b22-12- |
| InChIKey | QMZWWSDQVISFJF-UUYOSTAYSA-N |
| XLogP | 5.11 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|