C26H22Cl2N4O2 — CID 19060129
1-(2,6-dichlorophenyl)-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]methanamine (PubChem CID 19060129) has the molecular formula C26H22Cl2N4O2 and a molecular weight of 493.39 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]methanamine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]methanamine |
|---|---|
| PubChem CID | 19060129 |
| Molecular Formula | C26H22Cl2N4O2 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[(E)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]methanamine |
| SMILES | Cc1cc(/C=N/NCc2c(Cl)cccc2Cl)c(C)n1-c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H22Cl2N4O2/c1-17-14-21(15-29-30-16-24-25(27)4-3-5-26(24)28)18(2)31(17)22-10-6-19(7-11-22)20-8-12-23(13-9-20)32(33)34/h3-15,30H,16H2,1-2H3/b29-15+ |
| InChIKey | RMQRATAZRIHQQD-WKULSOCRSA-N |
| XLogP | 7.10 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|