C20H18Cl2IN3 — CID 19060172
1-(2,6-dichlorophenyl)-N-[(E)-[1-(2-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]methanamine (PubChem CID 19060172) has the molecular formula C20H18Cl2IN3 and a molecular weight of 498.20 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[(E)-[1-(2-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]methanamine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-[(E)-[1-(2-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]methanamine |
|---|---|
| PubChem CID | 19060172 |
| Molecular Formula | C20H18Cl2IN3 |
| Molecular Weight | 498.20 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[(E)-[1-(2-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]methanamine |
| SMILES | Cc1cc(/C=N/NCc2c(Cl)cccc2Cl)c(C)n1-c1ccccc1I |
| InChI | InChI=1S/C20H18Cl2IN3/c1-13-10-15(14(2)26(13)20-9-4-3-8-19(20)23)11-24-25-12-16-17(21)6-5-7-18(16)22/h3-11,25H,12H2,1-2H3/b24-11+ |
| InChIKey | UJXNFUKMXZHRDW-BHGWPJFGSA-N |
| XLogP | 6.13 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.20 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|