C21H21IN4O — CID 126382113
2-anilino-N-[(Z)-[1-(2-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 126382113) has the molecular formula C21H21IN4O and a molecular weight of 472.33 g/mol. Its IUPAC name is 2-anilino-N-[(Z)-[1-(2-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(Z)-[1-(2-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126382113 |
| Molecular Formula | C21H21IN4O |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 2-anilino-N-[(Z)-[1-(2-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(/C=N\NC(=O)CNc2ccccc2)c(C)n1-c1ccccc1I |
| InChI | InChI=1S/C21H21IN4O/c1-15-12-17(16(2)26(15)20-11-7-6-10-19(20)22)13-24-25-21(27)14-23-18-8-4-3-5-9-18/h3-13,23H,14H2,1-2H3,(H,25,27)/b24-13- |
| InChIKey | HYZAQDQVMPIXCS-CFRMEGHHSA-N |
| XLogP | 4.26 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|