C15H14Cl2N2 — CID 19060201
1-(2,6-dichlorophenyl)-N-[(E)-(2-methylphenyl)methylideneamino]methanamine (PubChem CID 19060201) has the molecular formula C15H14Cl2N2 and a molecular weight of 293.20 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[(E)-(2-methylphenyl)methylideneamino]methanamine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-[(E)-(2-methylphenyl)methylideneamino]methanamine |
|---|---|
| PubChem CID | 19060201 |
| Molecular Formula | C15H14Cl2N2 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[(E)-(2-methylphenyl)methylideneamino]methanamine |
| SMILES | Cc1ccccc1/C=N/NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H14Cl2N2/c1-11-5-2-3-6-12(11)9-18-19-10-13-14(16)7-4-8-15(13)17/h2-9,19H,10H2,1H3/b18-9+ |
| InChIKey | TYFPHRBAVKJCNL-GIJQJNRQSA-N |
| XLogP | 4.43 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|