C16H13Cl2N3 — CID 136822601
1-(2,6-dichlorophenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]methanamine (PubChem CID 136822601) has the molecular formula C16H13Cl2N3 and a molecular weight of 318.21 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]methanamine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]methanamine |
|---|---|
| PubChem CID | 136822601 |
| Molecular Formula | C16H13Cl2N3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]methanamine |
| SMILES | Clc1cccc(Cl)c1CN/N=C\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H13Cl2N3/c17-14-5-3-6-15(18)13(14)10-21-20-9-11-8-19-16-7-2-1-4-12(11)16/h1-9,19,21H,10H2/b20-9- |
| InChIKey | DMWHRCRJFDJCCY-UKWGHVSLSA-N |
| XLogP | 4.60 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|