C14H9Cl3N4 — CID 135683472
3,5,6-trichloro-N-[(E)-1H-indol-3-ylmethylideneamino]pyridin-2-amine (PubChem CID 135683472) has the molecular formula C14H9Cl3N4 and a molecular weight of 339.61 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[(E)-1H-indol-3-ylmethylideneamino]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[(E)-1H-indol-3-ylmethylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 135683472 |
| Molecular Formula | C14H9Cl3N4 |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 3,5,6-trichloro-N-[(E)-1H-indol-3-ylmethylideneamino]pyridin-2-amine |
| SMILES | Clc1cc(Cl)c(N/N=C/c2c[nH]c3ccccc23)nc1Cl |
| InChI | InChI=1S/C14H9Cl3N4/c15-10-5-11(16)14(20-13(10)17)21-19-7-8-6-18-12-4-2-1-3-9(8)12/h1-7,18H,(H,20,21)/b19-7+ |
| InChIKey | IIFBMSWTXRSCSR-FBCYGCLPSA-N |
| XLogP | 4.97 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|