C19H14N8O — CID 137082807
5-N-[(E)-1H-indol-3-ylmethylideneamino]-6-N-phenyl-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 137082807) has the molecular formula C19H14N8O and a molecular weight of 370.38 g/mol. Its IUPAC name is 5-N-[(E)-1H-indol-3-ylmethylideneamino]-6-N-phenyl-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 5-N-[(E)-1H-indol-3-ylmethylideneamino]-6-N-phenyl-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 137082807 |
| Molecular Formula | C19H14N8O |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 5-N-[(E)-1H-indol-3-ylmethylideneamino]-6-N-phenyl-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | C(=N/Nc1nc2nonc2nc1Nc1ccccc1)\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H14N8O/c1-2-6-13(7-3-1)22-16-17(24-19-18(23-16)26-28-27-19)25-21-11-12-10-20-15-9-5-4-8-14(12)15/h1-11,20H,(H,22,23,26)(H,24,25,27)/b21-11+ |
| InChIKey | IMZKSMDZVAMAHU-SRZZPIQSSA-N |
| XLogP | 3.68 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|