C17H10Br3N7O — CID 4583723
6-N-(3-bromophenyl)-5-N-[(2,5-dibromophenyl)methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 4583723) has the molecular formula C17H10Br3N7O and a molecular weight of 568.03 g/mol. Its IUPAC name is 6-N-(3-bromophenyl)-5-N-[(2,5-dibromophenyl)methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 6-N-(3-bromophenyl)-5-N-[(2,5-dibromophenyl)methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 4583723 |
| Molecular Formula | C17H10Br3N7O |
| Molecular Weight | 568.03 g/mol |
| Exact Mass | 564.85 |
| IUPAC Name | 6-N-(3-bromophenyl)-5-N-[(2,5-dibromophenyl)methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | Brc1cccc(Nc2nc3nonc3nc2NN=Cc2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C17H10Br3N7O/c18-10-2-1-3-12(7-10)22-14-15(24-17-16(23-14)26-28-27-17)25-21-8-9-6-11(19)4-5-13(9)20/h1-8H,(H,22,23,26)(H,24,25,27) |
| InChIKey | GQGTYNLIINTDFY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.03 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|