C17H12BrN7O3 — CID 136878208
4-[(Z)-[[6-(3-bromoanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]benzene-1,2-diol (PubChem CID 136878208) has the molecular formula C17H12BrN7O3 and a molecular weight of 442.23 g/mol. Its IUPAC name is 4-[(Z)-[[6-(3-bromoanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]benzene-1,2-diol.
| Compound Name | 4-[(Z)-[[6-(3-bromoanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136878208 |
| Molecular Formula | C17H12BrN7O3 |
| Molecular Weight | 442.23 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 4-[(Z)-[[6-(3-bromoanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(/C=N\Nc2nc3nonc3nc2Nc2cccc(Br)c2)cc1O |
| InChI | InChI=1S/C17H12BrN7O3/c18-10-2-1-3-11(7-10)20-14-15(22-17-16(21-14)24-28-25-17)23-19-8-9-4-5-12(26)13(27)6-9/h1-8,26-27H,(H,20,21,24)(H,22,23,25)/b19-8- |
| InChIKey | VDCUYHCYJUWJOO-UWVJOHFNSA-N |
| XLogP | 3.38 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|