C18H14N8O3 — CID 135958634
4-[(Z)-[[5-[(2Z)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]hydrazinylidene]methyl]phenol (PubChem CID 135958634) has the molecular formula C18H14N8O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is 4-[(Z)-[[5-[(2Z)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 4-[(Z)-[[5-[(2Z)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135958634 |
| Molecular Formula | C18H14N8O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-[(Z)-[[5-[(2Z)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-yl]hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccc(/C=N\Nc2nc3nonc3nc2N/N=C\c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H14N8O3/c27-13-5-1-11(2-6-13)9-19-23-15-16(22-18-17(21-15)25-29-26-18)24-20-10-12-3-7-14(28)8-4-12/h1-10,27-28H,(H,21,23,25)(H,22,24,26)/b19-9-,20-10- |
| InChIKey | GNOXMCIAXFYPKF-QJUDHZBZSA-N |
| XLogP | 2.32 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|