C21H20IN7O — CID 6322795
5-N-[(Z)-(4-tert-butylphenyl)methylideneamino]-6-N-(4-iodophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 6322795) has the molecular formula C21H20IN7O and a molecular weight of 513.34 g/mol. Its IUPAC name is 5-N-[(Z)-(4-tert-butylphenyl)methylideneamino]-6-N-(4-iodophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 5-N-[(Z)-(4-tert-butylphenyl)methylideneamino]-6-N-(4-iodophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 6322795 |
| Molecular Formula | C21H20IN7O |
| Molecular Weight | 513.34 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 5-N-[(Z)-(4-tert-butylphenyl)methylideneamino]-6-N-(4-iodophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | CC(C)(C)c1ccc(/C=N\Nc2nc3nonc3nc2Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C21H20IN7O/c1-21(2,3)14-6-4-13(5-7-14)12-23-27-18-17(24-16-10-8-15(22)9-11-16)25-19-20(26-18)29-30-28-19/h4-12H,1-3H3,(H,24,25,28)(H,26,27,29)/b23-12- |
| InChIKey | UNHOXLDJEALJQA-FMCGGJTJSA-N |
| XLogP | 5.10 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|