C26H33N7 — CID 45148689
3-N,5-N-bis[(E)-(4-tert-butylphenyl)methylideneamino]-6-methyl-1,2,4-triazine-3,5-diamine (PubChem CID 45148689) has the molecular formula C26H33N7 and a molecular weight of 443.60 g/mol. Its IUPAC name is 3-N,5-N-bis[(E)-(4-tert-butylphenyl)methylideneamino]-6-methyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N,5-N-bis[(E)-(4-tert-butylphenyl)methylideneamino]-6-methyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 45148689 |
| Molecular Formula | C26H33N7 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 3-N,5-N-bis[(E)-(4-tert-butylphenyl)methylideneamino]-6-methyl-1,2,4-triazine-3,5-diamine |
| SMILES | Cc1nnc(N/N=C/c2ccc(C(C)(C)C)cc2)nc1N/N=C/c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H33N7/c1-18-23(31-27-16-19-8-12-21(13-9-19)25(2,3)4)29-24(33-30-18)32-28-17-20-10-14-22(15-11-20)26(5,6)7/h8-17H,1-7H3,(H2,29,31,32,33)/b27-16+,28-17+ |
| InChIKey | OJNFOSKTWZLIJH-ODBZBXGJSA-N |
| XLogP | 5.67 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|