C26H33N7O2 — CID 18593774
3-N,5-N-bis[(E)-(3-butoxyphenyl)methylideneamino]-6-methyl-1,2,4-triazine-3,5-diamine (PubChem CID 18593774) has the molecular formula C26H33N7O2 and a molecular weight of 475.60 g/mol. Its IUPAC name is 3-N,5-N-bis[(E)-(3-butoxyphenyl)methylideneamino]-6-methyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N,5-N-bis[(E)-(3-butoxyphenyl)methylideneamino]-6-methyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 18593774 |
| Molecular Formula | C26H33N7O2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 3-N,5-N-bis[(E)-(3-butoxyphenyl)methylideneamino]-6-methyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCCOc1cccc(/C=N/Nc2nnc(C)c(N/N=C/c3cccc(OCCCC)c3)n2)c1 |
| InChI | InChI=1S/C26H33N7O2/c1-4-6-14-34-23-12-8-10-21(16-23)18-27-31-25-20(3)30-33-26(29-25)32-28-19-22-11-9-13-24(17-22)35-15-7-5-2/h8-13,16-19H,4-7,14-15H2,1-3H3,(H2,29,31,32,33)/b27-18+,28-19+ |
| InChIKey | PMWYFTMTWJXTCR-UKOHILRMSA-N |
| XLogP | 5.43 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|