C20H20N6 — CID 16736452
2-N,4-N-bis[(E)-(4-methylphenyl)methylideneamino]pyrimidine-2,4-diamine (PubChem CID 16736452) has the molecular formula C20H20N6 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-N,4-N-bis[(E)-(4-methylphenyl)methylideneamino]pyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[(E)-(4-methylphenyl)methylideneamino]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 16736452 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-N,4-N-bis[(E)-(4-methylphenyl)methylideneamino]pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(/C=N/Nc2ccnc(N/N=C/c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C20H20N6/c1-15-3-7-17(8-4-15)13-22-25-19-11-12-21-20(24-19)26-23-14-18-9-5-16(2)6-10-18/h3-14H,1-2H3,(H2,21,24,25,26)/b22-13+,23-14+ |
| InChIKey | DVBQFQDFNYNSSD-MSKUYSOUSA-N |
| XLogP | 3.99 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|