C12H12ClN5 — CID 137318867
6-chloro-4-N-[(4-methylphenyl)methylideneamino]pyrimidine-2,4-diamine (PubChem CID 137318867) has the molecular formula C12H12ClN5 and a molecular weight of 261.72 g/mol. Its IUPAC name is 6-chloro-4-N-[(4-methylphenyl)methylideneamino]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[(4-methylphenyl)methylideneamino]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 137318867 |
| Molecular Formula | C12H12ClN5 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 6-chloro-4-N-[(4-methylphenyl)methylideneamino]pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(C=NNc2cc(Cl)nc(N)n2)cc1 |
| InChI | InChI=1S/C12H12ClN5/c1-8-2-4-9(5-3-8)7-15-18-11-6-10(13)16-12(14)17-11/h2-7H,1H3,(H3,14,16,17,18) |
| InChIKey | DSBNVUGWMZJIBX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|