C12H6ClF5N4 — CID 2842018
6-chloro-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]pyrimidin-4-amine (PubChem CID 2842018) has the molecular formula C12H6ClF5N4 and a molecular weight of 336.65 g/mol. Its IUPAC name is 6-chloro-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]pyrimidin-4-amine |
|---|---|
| PubChem CID | 2842018 |
| Molecular Formula | C12H6ClF5N4 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 6-chloro-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]pyrimidin-4-amine |
| SMILES | Cc1nc(Cl)cc(NN=Cc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C12H6ClF5N4/c1-4-20-6(13)2-7(21-4)22-19-3-5-8(14)10(16)12(18)11(17)9(5)15/h2-3H,1H3,(H,20,21,22) |
| InChIKey | FCPBAZGRSDIGIQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|