C15H17ClFN3 — CID 58896800
N-(4-tert-butyl-3-fluorophenyl)-6-chloro-2-methylpyrimidin-4-amine (PubChem CID 58896800) has the molecular formula C15H17ClFN3 and a molecular weight of 293.77 g/mol. Its IUPAC name is N-(4-tert-butyl-3-fluorophenyl)-6-chloro-2-methylpyrimidin-4-amine.
| Compound Name | N-(4-tert-butyl-3-fluorophenyl)-6-chloro-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 58896800 |
| Molecular Formula | C15H17ClFN3 |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-(4-tert-butyl-3-fluorophenyl)-6-chloro-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(Cl)cc(Nc2ccc(C(C)(C)C)c(F)c2)n1 |
| InChI | InChI=1S/C15H17ClFN3/c1-9-18-13(16)8-14(19-9)20-10-5-6-11(12(17)7-10)15(2,3)4/h5-8H,1-4H3,(H,18,19,20) |
| InChIKey | HDEDDMITYMRYBA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |