C17H14F2N4 — CID 112877864
4-N,6-N-bis(4-fluorophenyl)-2-methylpyrimidine-4,6-diamine (PubChem CID 112877864) has the molecular formula C17H14F2N4 and a molecular weight of 312.32 g/mol. Its IUPAC name is 4-N,6-N-bis(4-fluorophenyl)-2-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-bis(4-fluorophenyl)-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112877864 |
| Molecular Formula | C17H14F2N4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4-N,6-N-bis(4-fluorophenyl)-2-methylpyrimidine-4,6-diamine |
| SMILES | Cc1nc(Nc2ccc(F)cc2)cc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H14F2N4/c1-11-20-16(22-14-6-2-12(18)3-7-14)10-17(21-11)23-15-8-4-13(19)5-9-15/h2-10H,1H3,(H2,20,21,22,23) |
| InChIKey | YOYVSRAOTLPMJL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |