C18H15FN4O2 — CID 113193456
3-[[6-(4-fluoroanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 113193456) has the molecular formula C18H15FN4O2 and a molecular weight of 338.34 g/mol. Its IUPAC name is 3-[[6-(4-fluoroanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-[[6-(4-fluoroanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113193456 |
| Molecular Formula | C18H15FN4O2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3-[[6-(4-fluoroanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | Cc1nc(Nc2ccc(F)cc2)cc(Nc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C18H15FN4O2/c1-11-20-16(22-14-7-5-13(19)6-8-14)10-17(21-11)23-15-4-2-3-12(9-15)18(24)25/h2-10H,1H3,(H,24,25)(H2,20,21,22,23) |
| InChIKey | GRRZZUVFURSPBQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |