C19H16FN3O2 — CID 56767974
3-[[6-ethyl-2-(4-fluorophenyl)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 56767974) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is 3-[[6-ethyl-2-(4-fluorophenyl)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-[[6-ethyl-2-(4-fluorophenyl)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 56767974 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-[[6-ethyl-2-(4-fluorophenyl)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | CCc1cc(Nc2cccc(C(=O)O)c2)nc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H16FN3O2/c1-2-15-11-17(21-16-5-3-4-13(10-16)19(24)25)23-18(22-15)12-6-8-14(20)9-7-12/h3-11H,2H2,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | OAWCTBWGDWEKFP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |